C21H23ClN4O6S — CID 55766458
4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 55766458) has the molecular formula C21H23ClN4O6S and a molecular weight of 494.96 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 55766458 |
| Molecular Formula | C21H23ClN4O6S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxy-N-[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(=O)(=O)/N=C3/CCCN3C)cc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C21H23ClN4O6S/c1-26-9-3-4-19(26)25-33(29,30)15-7-5-14(6-8-15)24-21(28)13-10-16(22)20(17(11-13)31-2)32-12-18(23)27/h5-8,10-11H,3-4,9,12H2,1-2H3,(H2,23,27)(H,24,28)/b25-19- |
| InChIKey | ZATYDWZRZXHMTE-PLRJNAJWSA-N |
| XLogP | 2.28 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|