C18H19N3O5S2 — CID 55968077
methyl 5-[[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]carbamoyl]thiophene-2-carboxylate (PubChem CID 55968077) has the molecular formula C18H19N3O5S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl 5-[[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]carbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]carbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55968077 |
| Molecular Formula | C18H19N3O5S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | methyl 5-[[4-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]carbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)/N=C3/CCCN3C)cc2)s1 |
| InChI | InChI=1S/C18H19N3O5S2/c1-21-11-3-4-16(21)20-28(24,25)13-7-5-12(6-8-13)19-17(22)14-9-10-15(27-14)18(23)26-2/h5-10H,3-4,11H2,1-2H3,(H,19,22)/b20-16- |
| InChIKey | WJWQNNLFWFFEEO-SILNSSARSA-N |
| XLogP | 2.60 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|