C18H17ClFN3O3S — CID 51956837
2-chloro-4-fluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 51956837) has the molecular formula C18H17ClFN3O3S and a molecular weight of 409.87 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 51956837 |
| Molecular Formula | C18H17ClFN3O3S |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-chloro-4-fluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)c2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17ClFN3O3S/c1-23-10-2-3-17(23)22-27(25,26)14-7-5-13(6-8-14)21-18(24)15-9-4-12(20)11-16(15)19/h4-9,11H,2-3,10H2,1H3,(H,21,24) |
| InChIKey | RKZXSJVRUZVFFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|