C19H18N4O3S — CID 22249375
N-(4-methylsulfonylphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 22249375) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-methylsulfonylphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22249375 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2cccnc2NCc2ccncc2)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-27(25,26)16-6-4-15(5-7-16)23-19(24)17-3-2-10-21-18(17)22-13-14-8-11-20-12-9-14/h2-12H,13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | QFGVGPSBDKEYOX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |