C24H20N4O2 — CID 20773471
N-(3-phenoxyphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 20773471) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(3-phenoxyphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-phenoxyphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 20773471 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-(3-phenoxyphenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)c1cccnc1NCc1ccncc1 |
| InChI | InChI=1S/C24H20N4O2/c29-24(22-10-5-13-26-23(22)27-17-18-11-14-25-15-12-18)28-19-6-4-9-21(16-19)30-20-7-2-1-3-8-20/h1-16H,17H2,(H,26,27)(H,28,29) |
| InChIKey | NNDHTJMIFWLTJW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |