C20H19ClN4O3 — CID 141081595
methyl 2-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]benzoate;hydrochloride (PubChem CID 141081595) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is methyl 2-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]benzoate;hydrochloride.
| Compound Name | methyl 2-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 141081595 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | methyl 2-[[2-(pyridin-4-ylmethylamino)pyridine-3-carbonyl]amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccnc1NCc1ccncc1.Cl |
| InChI | InChI=1S/C20H18N4O3.ClH/c1-27-20(26)15-5-2-3-7-17(15)24-19(25)16-6-4-10-22-18(16)23-13-14-8-11-21-12-9-14;/h2-12H,13H2,1H3,(H,22,23)(H,24,25);1H |
| InChIKey | SPGRMCAIECXVRJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |