C24H23N6O4- — CID 45138817
N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide nitrate (PubChem CID 45138817) has the molecular formula C24H23N6O4- and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide nitrate.
| Compound Name | N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide nitrate |
|---|---|
| PubChem CID | 45138817 |
| Molecular Formula | C24H23N6O4- |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide nitrate |
| SMILES | N#CC1(c2ccc(NC(=O)c3cccnc3NCc3ccncc3)cc2)CCCC1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C24H23N5O.NO3/c25-17-24(11-1-2-12-24)19-5-7-20(8-6-19)29-23(30)21-4-3-13-27-22(21)28-16-18-9-14-26-15-10-18;2-1(3)4/h3-10,13-15H,1-2,11-12,16H2,(H,27,28)(H,29,30);/q;-1 |
| InChIKey | KBTRSFDUVJXZRU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|