C34H31N5O4S — CID 45137170
N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide;naphthalene-2-sulfonic acid (PubChem CID 45137170) has the molecular formula C34H31N5O4S and a molecular weight of 605.72 g/mol. Its IUPAC name is N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide;naphthalene-2-sulfonic acid.
| Compound Name | N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide;naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 45137170 |
| Molecular Formula | C34H31N5O4S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | N-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide;naphthalene-2-sulfonic acid |
| SMILES | N#CC1(c2ccc(NC(=O)c3cccnc3NCc3ccncc3)cc2)CCCC1.O=S(=O)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23N5O.C10H8O3S/c25-17-24(11-1-2-12-24)19-5-7-20(8-6-19)29-23(30)21-4-3-13-27-22(21)28-16-18-9-14-26-15-10-18;11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h3-10,13-15H,1-2,11-12,16H2,(H,27,28)(H,29,30);1-7H,(H,11,12,13) |
| InChIKey | UZDNMRXJKKJZOB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|