C23H20N4O — CID 11326111
N-[4-(1-cyanocyclopropyl)phenyl]-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 11326111) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[4-(1-cyanocyclopropyl)phenyl]-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-[4-(1-cyanocyclopropyl)phenyl]-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 11326111 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[4-(1-cyanocyclopropyl)phenyl]-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | N#CC1(c2ccc(NC(=O)c3ccccc3NCc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C23H20N4O/c24-16-23(11-12-23)18-5-7-19(8-6-18)27-22(28)20-3-1-2-4-21(20)26-15-17-9-13-25-14-10-17/h1-10,13-14,26H,11-12,15H2,(H,27,28) |
| InChIKey | PKZBEWVAFRJOJW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |