C20H21N5O3S — CID 10136336
2-(pyridin-4-ylmethylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 10136336) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(pyridin-4-ylmethylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10136336 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(pyridin-4-ylmethylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cccnc2NCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H21N5O3S/c21-29(27,28)17-5-3-15(4-6-17)9-13-24-20(26)18-2-1-10-23-19(18)25-14-16-7-11-22-12-8-16/h1-8,10-12H,9,13-14H2,(H,23,25)(H,24,26)(H2,21,27,28) |
| InChIKey | LWDPTJDVDQEJNC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |