C17H22N4O3S — CID 108989235
1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 108989235) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108989235 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-methyl-1-(2-pyridin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | CN(CCc1ccncc1)C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-21(13-9-15-6-10-19-11-7-15)17(22)20-12-8-14-2-4-16(5-3-14)25(18,23)24/h2-7,10-11H,8-9,12-13H2,1H3,(H,20,22)(H2,18,23,24) |
| InChIKey | ATBRMHCGJDEYNO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |