C14H23N3O5S — CID 95133816
1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 95133816) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 95133816 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | COC[C@H](O)CN(C)C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23N3O5S/c1-17(9-12(18)10-22-2)14(19)16-8-7-11-3-5-13(6-4-11)23(15,20)21/h3-6,12,18H,7-10H2,1-2H3,(H,16,19)(H2,15,20,21)/t12-/m1/s1 |
| InChIKey | QTBURXPPPLFHEC-GFCCVEGCSA-N |
| XLogP | -0.47 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |