C16H25N3O5S — CID 113160044
2-[acetyl(3-methoxypropyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 113160044) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[acetyl(3-methoxypropyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[acetyl(3-methoxypropyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113160044 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[acetyl(3-methoxypropyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | COCCCN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)C(C)=O |
| InChI | InChI=1S/C16H25N3O5S/c1-13(20)19(10-3-11-24-2)12-16(21)18-9-8-14-4-6-15(7-5-14)25(17,22)23/h4-7H,3,8-12H2,1-2H3,(H,18,21)(H2,17,22,23) |
| InChIKey | MLJVXYURPPGCJY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|