C18H27N3O5S — CID 113117302
3-[acetyl(oxolan-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 113117302) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[acetyl(oxolan-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 113117302 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[acetyl(oxolan-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)NCCc1ccc(S(N)(=O)=O)cc1)CC1CCCO1 |
| InChI | InChI=1S/C18H27N3O5S/c1-14(22)21(13-16-3-2-12-26-16)11-9-18(23)20-10-8-15-4-6-17(7-5-15)27(19,24)25/h4-7,16H,2-3,8-13H2,1H3,(H,20,23)(H2,19,24,25) |
| InChIKey | ZZYNYGRUZZWEMV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |