C18H28N4O4S — CID 113105545
N-(oxolan-2-ylmethyl)-4-[2-(4-sulfamoylphenyl)ethyl]piperazine-1-carboxamide (PubChem CID 113105545) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[2-(4-sulfamoylphenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-[2-(4-sulfamoylphenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105545 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[2-(4-sulfamoylphenyl)ethyl]piperazine-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCN2CCN(C(=O)NCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O4S/c19-27(24,25)17-5-3-15(4-6-17)7-8-21-9-11-22(12-10-21)18(23)20-14-16-2-1-13-26-16/h3-6,16H,1-2,7-14H2,(H,20,23)(H2,19,24,25) |
| InChIKey | NASWZPJWTHYNPW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |