C17H27N3O4S — CID 113122472
3-[acetyl(tert-butyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 113122472) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-[acetyl(tert-butyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-[acetyl(tert-butyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 113122472 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-[acetyl(tert-butyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)NCCc1ccc(S(N)(=O)=O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H27N3O4S/c1-13(21)20(17(2,3)4)12-10-16(22)19-11-9-14-5-7-15(8-6-14)25(18,23)24/h5-8H,9-12H2,1-4H3,(H,19,22)(H2,18,23,24) |
| InChIKey | LAHMQOAQXCWHKP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |