C18H29N3O3S — CID 46685647
3-(3,5-dimethylpiperidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 46685647) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46685647 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC1CC(C)CN(CCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C18H29N3O3S/c1-14-11-15(2)13-21(12-14)10-8-18(22)20-9-7-16-3-5-17(6-4-16)25(19,23)24/h3-6,14-15H,7-13H2,1-2H3,(H,20,22)(H2,19,23,24) |
| InChIKey | HULXGINMXPMNGB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |