C21H28N4O3S — CID 56526997
3-(3-anilinopyrrolidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 56526997) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 3-(3-anilinopyrrolidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-(3-anilinopyrrolidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 56526997 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-(3-anilinopyrrolidin-1-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCN2CCC(Nc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c22-29(27,28)20-8-6-17(7-9-20)10-13-23-21(26)12-15-25-14-11-19(16-25)24-18-4-2-1-3-5-18/h1-9,19,24H,10-16H2,(H,23,26)(H2,22,27,28) |
| InChIKey | GANCEQLGYAVTDT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |