C28H33N3O3S — CID 25205608
N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 25205608) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 25205608 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)NC2CCN(CCC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H33N3O3S/c29-35(33,34)26-13-11-22(12-14-26)21-28(32)30-25-15-18-31(19-16-25)20-17-27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,25,27H,15-21H2,(H,30,32)(H2,29,33,34) |
| InChIKey | GIAHIIDNWMEKCF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |