C21H27N3O4S — CID 56553050
N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56553050) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56553050 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccccc1CN1CCC(NC(=O)Cc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C21H27N3O4S/c1-28-20-5-3-2-4-17(20)15-24-12-10-18(11-13-24)23-21(25)14-16-6-8-19(9-7-16)29(22,26)27/h2-9,18H,10-15H2,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | IFEFRNFKEFNMMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |