C25H32N2O3 — CID 55979610
N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyloxane-4-carboxamide (PubChem CID 55979610) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 55979610 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyloxane-4-carboxamide |
| SMILES | COc1ccccc1CN1CCC(NC(=O)C2(c3ccccc3)CCOCC2)CC1 |
| InChI | InChI=1S/C25H32N2O3/c1-29-23-10-6-5-7-20(23)19-27-15-11-22(12-16-27)26-24(28)25(13-17-30-18-14-25)21-8-3-2-4-9-21/h2-10,22H,11-19H2,1H3,(H,26,28) |
| InChIKey | SXLRIPUNZPRYHC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |