C28H31N3O3 — CID 55951097
N-[2-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 55951097) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[2-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 55951097 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[2-[[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | COc1ccccc1CN1CCC(NC(=O)CNC(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H31N3O3/c1-34-26-10-6-5-9-24(26)20-31-17-15-25(16-18-31)30-27(32)19-29-28(33)23-13-11-22(12-14-23)21-7-3-2-4-8-21/h2-14,25H,15-20H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | RAGGUAOMQOJJMN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |