C18H28N4O5S2 — CID 55989752
N-cyclopentyl-3-[4-(4-sulfamoylphenyl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 55989752) has the molecular formula C18H28N4O5S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-cyclopentyl-3-[4-(4-sulfamoylphenyl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-cyclopentyl-3-[4-(4-sulfamoylphenyl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55989752 |
| Molecular Formula | C18H28N4O5S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-cyclopentyl-3-[4-(4-sulfamoylphenyl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(CCC(=O)NC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O5S2/c19-28(24,25)16-5-7-17(8-6-16)29(26,27)22-13-11-21(12-14-22)10-9-18(23)20-15-3-1-2-4-15/h5-8,15H,1-4,9-14H2,(H,20,23)(H2,19,24,25) |
| InChIKey | WWEHNAJOFLOTRB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |