benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate

C28H31NO2 — CID 25223025

IUPACbenzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate
SMILESO=C(OCc1ccccc1)C1CCN(CCC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C28H31NO2/c30-28(31-22-23-10-4-1-5-11-23)26-16-19-29(20-17-26)21-18-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,26-27H,16-22H2
InChIKeyOBKKTRGYPUYVOP-UHFFFAOYSA-N
MW413.56 g/mol
LogP5.66
Rot. Bonds8

About benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate

benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate (PubChem CID 25223025) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate.

Molecular Properties

Compound Namebenzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate
PubChem CID25223025
Molecular FormulaC28H31NO2
Molecular Weight413.56 g/mol
Exact Mass413.24
IUPAC Namebenzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate
SMILESO=C(OCc1ccccc1)C1CCN(CCC(c2ccccc2)c2ccccc2)CC1
InChIInChI=1S/C28H31NO2/c30-28(31-22-23-10-4-1-5-11-23)26-16-19-29(20-17-26)21-18-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,26-27H,16-22H2
InChIKeyOBKKTRGYPUYVOP-UHFFFAOYSA-N
XLogP5.66
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500413.56
LogP ≤ 55.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate?
The IUPAC name of benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate (CID 25223025) is benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate.
What is the SMILES notation for benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate?
The canonical SMILES for benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate is O=C(OCc1ccccc1)C1CCN(CCC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate?
The InChIKey is OBKKTRGYPUYVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO2/c30-28(31-22-23-10-4-1-5-11-23)26-16-19-29(20-17-26)21-18-27(24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-15,26-27H,16-22H2.
What are the key properties of benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate?
benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate has a molecular weight of 413.56 g/mol, XLogP of 5.66, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-(3,3-diphenylpropyl)piperidine-4-carboxylate is sourced from PubChem (CID 25223025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).