C24H28F6N2O4 — CID 22254650
1-(3,3-diphenylpropyl)piperidin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22254650) has the molecular formula C24H28F6N2O4 and a molecular weight of 522.49 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)piperidin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(3,3-diphenylpropyl)piperidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22254650 |
| Molecular Formula | C24H28F6N2O4 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 1-(3,3-diphenylpropyl)piperidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC1CCN(CCC(c2ccccc2)c2ccccc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N2.2C2HF3O2/c21-19-11-14-22(15-12-19)16-13-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18;2*3-2(4,5)1(6)7/h1-10,19-20H,11-16,21H2;2*(H,6,7) |
| InChIKey | UNJHFOIEBKGRJE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |