C12H15F3N2O2 — CID 122677958
(3S)-1-phenylpyrrolidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 122677958) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is (3S)-1-phenylpyrrolidin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-1-phenylpyrrolidin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122677958 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3S)-1-phenylpyrrolidin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1CCN(c2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2.C2HF3O2/c11-9-6-7-12(8-9)10-4-2-1-3-5-10;3-2(4,5)1(6)7/h1-5,9H,6-8,11H2;(H,6,7)/t9-;/m0./s1 |
| InChIKey | FFZZCVURCCGGCY-FVGYRXGTSA-N |
| XLogP | 1.86 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |