C12H14F3N3O — CID 55029458
4-(3-aminopyrrolidin-1-yl)-2-(trifluoromethyl)benzamide (PubChem CID 55029458) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 4-(3-aminopyrrolidin-1-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-(3-aminopyrrolidin-1-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55029458 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-(3-aminopyrrolidin-1-yl)-2-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1ccc(N2CCC(N)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O/c13-12(14,15)10-5-8(1-2-9(10)11(17)19)18-4-3-7(16)6-18/h1-2,5,7H,3-4,6,16H2,(H2,17,19) |
| InChIKey | VRLCONCQAGMXCD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |