C28H32N2O — CID 18381967
N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-N-methylbenzamide (PubChem CID 18381967) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-N-methylbenzamide.
| Compound Name | N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18381967 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[1-(3,3-diphenylpropyl)piperidin-4-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)C1CCN(CCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N2O/c1-29(28(31)25-15-9-4-10-16-25)26-17-20-30(21-18-26)22-19-27(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-16,26-27H,17-22H2,1H3 |
| InChIKey | WDDXFQHTPPBWKK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |