C17H26N4O5S — CID 27154557
ethyl 4-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]piperazine-1-carboxylate (PubChem CID 27154557) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 27154557 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | ethyl 4-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C17H26N4O5S/c1-2-26-17(23)21-11-9-20(10-12-21)13-16(22)19-8-7-14-3-5-15(6-4-14)27(18,24)25/h3-6H,2,7-13H2,1H3,(H,19,22)(H2,18,24,25) |
| InChIKey | GEFMSABOUAESKF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |