C16H24N4O5S — CID 108989656
ethyl 4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]piperazine-1-carboxylate (PubChem CID 108989656) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is ethyl 4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108989656 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | ethyl 4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H24N4O5S/c1-2-25-16(22)20-11-9-19(10-12-20)15(21)18-8-7-13-3-5-14(6-4-13)26(17,23)24/h3-6H,2,7-12H2,1H3,(H,18,21)(H2,17,23,24) |
| InChIKey | PZZWJYWJXAJYSD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |