C18H27N3O4 — CID 112972060
ethyl 4-[2-(4-ethylphenoxy)ethylcarbamoyl]piperazine-1-carboxylate (PubChem CID 112972060) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 4-[2-(4-ethylphenoxy)ethylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-ethylphenoxy)ethylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112972060 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | ethyl 4-[2-(4-ethylphenoxy)ethylcarbamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)NCCOc2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O4/c1-3-15-5-7-16(8-6-15)25-14-9-19-17(22)20-10-12-21(13-11-20)18(23)24-4-2/h5-8H,3-4,9-14H2,1-2H3,(H,19,22) |
| InChIKey | KQSGQAGEIORPBS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|