C20H29N3O4 — CID 112975032
ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylcarbamoyl]piperazine-1-carboxylate (PubChem CID 112975032) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112975032 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylcarbamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)NCCOc2cccc3c2CCCC3)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-2-26-20(25)23-13-11-22(12-14-23)19(24)21-10-15-27-18-9-5-7-16-6-3-4-8-17(16)18/h5,7,9H,2-4,6,8,10-15H2,1H3,(H,21,24) |
| InChIKey | PSMYDICULBESIE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|