C19H27N3O3 — CID 112974994
4-acetyl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide (PubChem CID 112974994) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-acetyl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-acetyl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112974994 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 4-acetyl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)NCCOc2cccc3c2CCCC3)CC1 |
| InChI | InChI=1S/C19H27N3O3/c1-15(23)21-10-12-22(13-11-21)19(24)20-9-14-25-18-8-4-6-16-5-2-3-7-17(16)18/h4,6,8H,2-3,5,7,9-14H2,1H3,(H,20,24) |
| InChIKey | WDBHCWSLYYBVBT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|