C21H27N5O2 — CID 112975037
4-pyrimidin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide (PubChem CID 112975037) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-pyrimidin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112975037 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-pyrimidin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCOc1cccc2c1CCCC2)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H27N5O2/c27-21(26-14-12-25(13-15-26)20-22-9-4-10-23-20)24-11-16-28-19-8-3-6-17-5-1-2-7-18(17)19/h3-4,6,8-10H,1-2,5,7,11-16H2,(H,24,27) |
| InChIKey | WYCLHWRCUCZYSF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|