C22H28N4O2 — CID 112974901
4-pyridin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]piperazine-1-carboxamide (PubChem CID 112974901) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-pyridin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112974901 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-pyridin-2-yl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)CCCC2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H28N4O2/c27-22(26-14-12-25(13-15-26)21-7-3-4-10-23-21)24-11-16-28-20-9-8-18-5-1-2-6-19(18)17-20/h3-4,7-10,17H,1-2,5-6,11-16H2,(H,24,27) |
| InChIKey | BALDQJFJOIDSAK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|