C18H20ClFN4O2 — CID 112977019
N-[2-(2-chloro-4-fluorophenoxy)ethyl]-4-pyridin-2-ylpiperazine-1-carboxamide (PubChem CID 112977019) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenoxy)ethyl]-4-pyridin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-4-pyridin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 112977019 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-4-pyridin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1Cl)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20ClFN4O2/c19-15-13-14(20)4-5-16(15)26-12-7-22-18(25)24-10-8-23(9-11-24)17-3-1-2-6-21-17/h1-6,13H,7-12H2,(H,22,25) |
| InChIKey | LNVSXDCCUQPYLW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|