C21H28N4O2 — CID 112974307
4-pyridin-2-yl-N-[2-(2,3,6-trimethylphenoxy)ethyl]piperazine-1-carboxamide (PubChem CID 112974307) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-[2-(2,3,6-trimethylphenoxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-pyridin-2-yl-N-[2-(2,3,6-trimethylphenoxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112974307 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-pyridin-2-yl-N-[2-(2,3,6-trimethylphenoxy)ethyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(OCCNC(=O)N2CCN(c3ccccn3)CC2)c1C |
| InChI | InChI=1S/C21H28N4O2/c1-16-7-8-17(2)20(18(16)3)27-15-10-23-21(26)25-13-11-24(12-14-25)19-6-4-5-9-22-19/h4-9H,10-15H2,1-3H3,(H,23,26) |
| InChIKey | WCGOIGOSWOBWKN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|