C18H18ClFN2O2 — CID 112977042
N-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 112977042) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 112977042 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1Cl)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H18ClFN2O2/c19-15-12-14(20)7-8-17(15)24-11-9-21-18(23)22-10-3-5-13-4-1-2-6-16(13)22/h1-2,4,6-8,12H,3,5,9-11H2,(H,21,23) |
| InChIKey | UQEJOJCMVLDKSL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|