C21H26N2O2 — CID 112974330
N-[2-(2,3,6-trimethylphenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 112974330) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[2-(2,3,6-trimethylphenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[2-(2,3,6-trimethylphenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 112974330 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[2-(2,3,6-trimethylphenoxy)ethyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | Cc1ccc(C)c(OCCNC(=O)N2CCCc3ccccc32)c1C |
| InChI | InChI=1S/C21H26N2O2/c1-15-10-11-16(2)20(17(15)3)25-14-12-22-21(24)23-13-6-8-18-7-4-5-9-19(18)23/h4-5,7,9-11H,6,8,12-14H2,1-3H3,(H,22,24) |
| InChIKey | SUHZJNIVQSOHOC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|