C13H16N2O2 — CID 150484451
N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 150484451) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 150484451 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCC1CO1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C13H16N2O2/c16-13(14-8-11-9-17-11)15-7-3-5-10-4-1-2-6-12(10)15/h1-2,4,6,11H,3,5,7-9H2,(H,14,16) |
| InChIKey | HUMYMONSKNZYGA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|