C15H20N2O2 — CID 47191359
N-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 47191359) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 47191359 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O2/c18-15(16-11-13-7-4-10-19-13)17-9-3-6-12-5-1-2-8-14(12)17/h1-2,5,8,13H,3-4,6-7,9-11H2,(H,16,18) |
| InChIKey | QMMIGGMLBXQFEK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |