C15H25N5O2 — CID 121495669
N-(2-propoxyethyl)-4-pyrimidin-2-yl-1,4-diazepane-1-carboxamide (PubChem CID 121495669) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(2-propoxyethyl)-4-pyrimidin-2-yl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(2-propoxyethyl)-4-pyrimidin-2-yl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 121495669 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-(2-propoxyethyl)-4-pyrimidin-2-yl-1,4-diazepane-1-carboxamide |
| SMILES | CCCOCCNC(=O)N1CCCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H25N5O2/c1-2-12-22-13-7-18-15(21)20-9-4-8-19(10-11-20)14-16-5-3-6-17-14/h3,5-6H,2,4,7-13H2,1H3,(H,18,21) |
| InChIKey | YYIPFQAKSYZCRL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|