C17H20FN5O — CID 27532293
N-[2-(4-fluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 27532293) has the molecular formula C17H20FN5O and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 27532293 |
| Molecular Formula | C17H20FN5O |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20FN5O/c18-15-4-2-14(3-5-15)6-9-21-17(24)23-12-10-22(11-13-23)16-19-7-1-8-20-16/h1-5,7-8H,6,9-13H2,(H,21,24) |
| InChIKey | FTQRVBDSAPPDTO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |