C16H25N5O4 — CID 122022127
4-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepane-1-carbonyl]amino]butanoic acid (PubChem CID 122022127) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepane-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepane-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022127 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepane-1-carbonyl]amino]butanoic acid |
| SMILES | CCOc1ccnc(N2CCCN(C(=O)NCCCC(=O)O)CC2)n1 |
| InChI | InChI=1S/C16H25N5O4/c1-2-25-13-6-8-17-15(19-13)20-9-4-10-21(12-11-20)16(24)18-7-3-5-14(22)23/h6,8H,2-5,7,9-12H2,1H3,(H,18,24)(H,22,23) |
| InChIKey | OIRNKADEYKRIDD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|