C16H22FN3O3 — CID 122022378
4-[[4-(2-fluorophenyl)-1,4-diazepane-1-carbonyl]amino]butanoic acid (PubChem CID 122022378) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-[[4-(2-fluorophenyl)-1,4-diazepane-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(2-fluorophenyl)-1,4-diazepane-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022378 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[[4-(2-fluorophenyl)-1,4-diazepane-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H22FN3O3/c17-13-5-1-2-6-14(13)19-9-4-10-20(12-11-19)16(23)18-8-3-7-15(21)22/h1-2,5-6H,3-4,7-12H2,(H,18,23)(H,21,22) |
| InChIKey | OFEOZPNKYFFWAE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|