C20H31FN4O2 — CID 126449328
4-(2-fluorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]piperazine-1-carboxamide (PubChem CID 126449328) has the molecular formula C20H31FN4O2 and a molecular weight of 378.49 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-fluorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126449328 |
| Molecular Formula | C20H31FN4O2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4-(2-fluorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCCN1CCCC[C@@H]1CO)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H31FN4O2/c21-18-7-1-2-8-19(18)24-12-14-25(15-13-24)20(27)22-9-5-11-23-10-4-3-6-17(23)16-26/h1-2,7-8,17,26H,3-6,9-16H2,(H,22,27)/t17-/m1/s1 |
| InChIKey | VENAXEKAVRTJNZ-QGZVFWFLSA-N |
| XLogP | 1.89 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|