C18H26F2N4O — CID 166307882
2-(fluoromethyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]azetidine-1-carboxamide (PubChem CID 166307882) has the molecular formula C18H26F2N4O and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(fluoromethyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]azetidine-1-carboxamide.
| Compound Name | 2-(fluoromethyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 166307882 |
| Molecular Formula | C18H26F2N4O |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-(fluoromethyl)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]azetidine-1-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)N1CCC1CF |
| InChI | InChI=1S/C18H26F2N4O/c19-14-15-6-9-24(15)18(25)21-7-3-8-22-10-12-23(13-11-22)17-5-2-1-4-16(17)20/h1-2,4-5,15H,3,6-14H2,(H,21,25) |
| InChIKey | CCAMPNXLINGCRX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|