C23H33FN4O2 — CID 5307425
1-cyclopentyl-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 5307425) has the molecular formula C23H33FN4O2 and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-cyclopentyl-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5307425 |
| Molecular Formula | C23H33FN4O2 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-cyclopentyl-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)C1CCC(=O)N1C1CCCC1 |
| InChI | InChI=1S/C23H33FN4O2/c24-19-8-3-4-9-20(19)27-16-14-26(15-17-27)13-5-12-25-23(30)21-10-11-22(29)28(21)18-6-1-2-7-18/h3-4,8-9,18,21H,1-2,5-7,10-17H2,(H,25,30) |
| InChIKey | MJPMHRZGIOIVLD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|