C24H28FN5O3 — CID 46357022
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide (PubChem CID 46357022) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 46357022 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
| SMILES | Cn1c(=O)c(=O)n(CC(=O)NCCCN2CCN(c3ccccc3F)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H28FN5O3/c1-27-20-9-4-5-10-21(20)30(24(33)23(27)32)17-22(31)26-11-6-12-28-13-15-29(16-14-28)19-8-3-2-7-18(19)25/h2-5,7-10H,6,11-17H2,1H3,(H,26,31) |
| InChIKey | SDGLLVDHOPDBDR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|