C26H33N5O3 — CID 46357058
2-(4-methyl-2,3-dioxoquinoxalin-1-yl)-N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 46357058) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-(4-methyl-2,3-dioxoquinoxalin-1-yl)-N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-(4-methyl-2,3-dioxoquinoxalin-1-yl)-N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 46357058 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-(4-methyl-2,3-dioxoquinoxalin-1-yl)-N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)Cn3c(=O)c(=O)n(C)c4ccccc43)CC2C)c1 |
| InChI | InChI=1S/C26H33N5O3/c1-19-8-6-9-21(16-19)30-15-14-29(17-20(30)2)13-7-12-27-24(32)18-31-23-11-5-4-10-22(23)28(3)25(33)26(31)34/h4-6,8-11,16,20H,7,12-15,17-18H2,1-3H3,(H,27,32) |
| InChIKey | ZKTSICPCGASZTL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|